C11H11F2NO2 — CID 83372564
6-(difluoromethoxy)-1,2,3,4-tetrahydroisoquinoline-1-carbaldehyde (PubChem CID 83372564) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 6-(difluoromethoxy)-1,2,3,4-tetrahydroisoquinoline-1-carbaldehyde.
| Compound Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydroisoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 83372564 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 6-(difluoromethoxy)-1,2,3,4-tetrahydroisoquinoline-1-carbaldehyde |
| SMILES | O=CC1NCCc2cc(OC(F)F)ccc21 |
| InChI | InChI=1S/C11H11F2NO2/c12-11(13)16-8-1-2-9-7(5-8)3-4-14-10(9)6-15/h1-2,5-6,10-11,14H,3-4H2 |
| InChIKey | LOBIKOHWNYFORE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|