About 4-amino-3-benzoylbenzoic acid
4-amino-3-benzoylbenzoic acid (PubChem CID 83381344) has the molecular formula C14H11NO3
and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-amino-3-benzoylbenzoic acid.
Molecular Properties
| Compound Name | 4-amino-3-benzoylbenzoic acid |
| PubChem CID | 83381344 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 4-amino-3-benzoylbenzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H11NO3/c15-12-7-6-10(14(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,15H2,(H,17,18) |
| InChIKey | VXAANIFHFNNVJN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-benzoylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-benzoylbenzoic acid?
The IUPAC name of 4-amino-3-benzoylbenzoic acid (CID 83381344) is 4-amino-3-benzoylbenzoic acid.
What is the SMILES notation for 4-amino-3-benzoylbenzoic acid?
The canonical SMILES for 4-amino-3-benzoylbenzoic acid is Nc1ccc(C(=O)O)cc1C(=O)c1ccccc1.
What is the InChIKey of 4-amino-3-benzoylbenzoic acid?
The InChIKey is VXAANIFHFNNVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c15-12-7-6-10(14(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,15H2,(H,17,18).
What are the key properties of 4-amino-3-benzoylbenzoic acid?
4-amino-3-benzoylbenzoic acid has a molecular weight of 241.25 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-benzoylbenzoic acid is sourced from PubChem (CID 83381344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).