4-amino-3-benzoylbenzoic acid

C14H11NO3 — CID 83381344

IUPAC4-amino-3-benzoylbenzoic acid
SMILESNc1ccc(C(=O)O)cc1C(=O)c1ccccc1
InChIInChI=1S/C14H11NO3/c15-12-7-6-10(14(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,15H2,(H,17,18)
InChIKeyVXAANIFHFNNVJN-UHFFFAOYSA-N
MW241.25 g/mol
LogP2.20
Rot. Bonds3

About 4-amino-3-benzoylbenzoic acid

4-amino-3-benzoylbenzoic acid (PubChem CID 83381344) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-amino-3-benzoylbenzoic acid.

Molecular Properties

Compound Name4-amino-3-benzoylbenzoic acid
PubChem CID83381344
Molecular FormulaC14H11NO3
Molecular Weight241.25 g/mol
Exact Mass241.07
IUPAC Name4-amino-3-benzoylbenzoic acid
SMILESNc1ccc(C(=O)O)cc1C(=O)c1ccccc1
InChIInChI=1S/C14H11NO3/c15-12-7-6-10(14(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,15H2,(H,17,18)
InChIKeyVXAANIFHFNNVJN-UHFFFAOYSA-N
XLogP2.20
TPSA80.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.25
LogP ≤ 52.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 4-amino-3-benzoylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-3-benzoylbenzoic acid?
The IUPAC name of 4-amino-3-benzoylbenzoic acid (CID 83381344) is 4-amino-3-benzoylbenzoic acid.
What is the SMILES notation for 4-amino-3-benzoylbenzoic acid?
The canonical SMILES for 4-amino-3-benzoylbenzoic acid is Nc1ccc(C(=O)O)cc1C(=O)c1ccccc1.
What is the InChIKey of 4-amino-3-benzoylbenzoic acid?
The InChIKey is VXAANIFHFNNVJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO3/c15-12-7-6-10(14(17)18)8-11(12)13(16)9-4-2-1-3-5-9/h1-8H,15H2,(H,17,18).
What are the key properties of 4-amino-3-benzoylbenzoic acid?
4-amino-3-benzoylbenzoic acid has a molecular weight of 241.25 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-benzoylbenzoic acid is sourced from PubChem (CID 83381344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).