About 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene
1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene (PubChem CID 83381808) has the molecular formula C9H8BrF3
and a molecular weight of 253.06 g/mol. Its IUPAC name is 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene |
| PubChem CID | 83381808 |
| Molecular Formula | C9H8BrF3 |
| Molecular Weight | 253.06 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene |
| SMILES | CC(c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3/c1-6(9(11,12)13)7-3-2-4-8(10)5-7/h2-6H,1H3 |
| InChIKey | VWIVLWYXQGXZNO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.06 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene?
The IUPAC name of 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene (CID 83381808) is 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene.
What is the SMILES notation for 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene?
The canonical SMILES for 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene is CC(c1cccc(Br)c1)C(F)(F)F.
What is the InChIKey of 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene?
The InChIKey is VWIVLWYXQGXZNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3/c1-6(9(11,12)13)7-3-2-4-8(10)5-7/h2-6H,1H3.
What are the key properties of 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene?
1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene has a molecular weight of 253.06 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(1,1,1-trifluoropropan-2-yl)benzene is sourced from PubChem (CID 83381808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).