About 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine
3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine (PubChem CID 83382721) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine.
Analyze 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine?
The IUPAC name of 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine (CID 83382721) is 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine.
What is the SMILES notation for 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine?
The canonical SMILES for 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine is Brc1ncc2n1CCCC2.
What is the InChIKey of 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine?
The InChIKey is SIPBOCCQDYQFJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c8-7-9-5-6-3-1-2-4-10(6)7/h5H,1-4H2.
What are the key properties of 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine?
3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine has a molecular weight of 201.07 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine is sourced from PubChem (CID 83382721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).