About 2-bromo-5-pyridin-3-yl-1,3-oxazole
2-bromo-5-pyridin-3-yl-1,3-oxazole (PubChem CID 83382778) has the molecular formula C8H5BrN2O
and a molecular weight of 225.05 g/mol. Its IUPAC name is 2-bromo-5-pyridin-3-yl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-bromo-5-pyridin-3-yl-1,3-oxazole |
| PubChem CID | 83382778 |
| Molecular Formula | C8H5BrN2O |
| Molecular Weight | 225.05 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 2-bromo-5-pyridin-3-yl-1,3-oxazole |
| SMILES | Brc1ncc(-c2cccnc2)o1 |
| InChI | InChI=1S/C8H5BrN2O/c9-8-11-5-7(12-8)6-2-1-3-10-4-6/h1-5H |
| InChIKey | NRKULKCEOXRROM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.05 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-5-pyridin-3-yl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-pyridin-3-yl-1,3-oxazole?
The IUPAC name of 2-bromo-5-pyridin-3-yl-1,3-oxazole (CID 83382778) is 2-bromo-5-pyridin-3-yl-1,3-oxazole.
What is the SMILES notation for 2-bromo-5-pyridin-3-yl-1,3-oxazole?
The canonical SMILES for 2-bromo-5-pyridin-3-yl-1,3-oxazole is Brc1ncc(-c2cccnc2)o1.
What is the InChIKey of 2-bromo-5-pyridin-3-yl-1,3-oxazole?
The InChIKey is NRKULKCEOXRROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2O/c9-8-11-5-7(12-8)6-2-1-3-10-4-6/h1-5H.
What are the key properties of 2-bromo-5-pyridin-3-yl-1,3-oxazole?
2-bromo-5-pyridin-3-yl-1,3-oxazole has a molecular weight of 225.05 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-pyridin-3-yl-1,3-oxazole is sourced from PubChem (CID 83382778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).