About 2-fluoro-3-isocyanato-N,N-dimethylaniline
2-fluoro-3-isocyanato-N,N-dimethylaniline (PubChem CID 83382925) has the molecular formula C9H9FN2O
and a molecular weight of 180.18 g/mol. Its IUPAC name is 2-fluoro-3-isocyanato-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-fluoro-3-isocyanato-N,N-dimethylaniline |
| PubChem CID | 83382925 |
| Molecular Formula | C9H9FN2O |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 2-fluoro-3-isocyanato-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(N=C=O)c1F |
| InChI | InChI=1S/C9H9FN2O/c1-12(2)8-5-3-4-7(9(8)10)11-6-13/h3-5H,1-2H3 |
| InChIKey | PRVBKGATKXZMNN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-isocyanato-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-isocyanato-N,N-dimethylaniline?
The IUPAC name of 2-fluoro-3-isocyanato-N,N-dimethylaniline (CID 83382925) is 2-fluoro-3-isocyanato-N,N-dimethylaniline.
What is the SMILES notation for 2-fluoro-3-isocyanato-N,N-dimethylaniline?
The canonical SMILES for 2-fluoro-3-isocyanato-N,N-dimethylaniline is CN(C)c1cccc(N=C=O)c1F.
What is the InChIKey of 2-fluoro-3-isocyanato-N,N-dimethylaniline?
The InChIKey is PRVBKGATKXZMNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN2O/c1-12(2)8-5-3-4-7(9(8)10)11-6-13/h3-5H,1-2H3.
What are the key properties of 2-fluoro-3-isocyanato-N,N-dimethylaniline?
2-fluoro-3-isocyanato-N,N-dimethylaniline has a molecular weight of 180.18 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-isocyanato-N,N-dimethylaniline is sourced from PubChem (CID 83382925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).