C9H13FN2 — CID 83383786
4-(aminomethyl)-3-fluoro-N,N-dimethylaniline (PubChem CID 83383786) has the molecular formula C9H13FN2 and a molecular weight of 168.21 g/mol. Its IUPAC name is 4-(aminomethyl)-3-fluoro-N,N-dimethylaniline.
| Compound Name | 4-(aminomethyl)-3-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 83383786 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 4-(aminomethyl)-3-fluoro-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CN)c(F)c1 |
| InChI | InChI=1S/C9H13FN2/c1-12(2)8-4-3-7(6-11)9(10)5-8/h3-5H,6,11H2,1-2H3 |
| InChIKey | GLLZUCBGNVSAKG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |