About 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide
2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide (PubChem CID 83385991) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide |
| PubChem CID | 83385991 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/O)c(N)c1 |
| InChI | InChI=1S/C8H11N3O2/c1-13-5-2-3-6(7(9)4-5)8(10)11-12/h2-4,12H,9H2,1H3,(H2,10,11) |
| InChIKey | LSBHYUFNTPNCLR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide?
The IUPAC name of 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide (CID 83385991) is 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide.
What is the SMILES notation for 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide?
The canonical SMILES for 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide is COc1ccc(/C(N)=N/O)c(N)c1.
What is the InChIKey of 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide?
The InChIKey is LSBHYUFNTPNCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-13-5-2-3-6(7(9)4-5)8(10)11-12/h2-4,12H,9H2,1H3,(H2,10,11).
What are the key properties of 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide?
2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide has a molecular weight of 181.19 g/mol, XLogP of 0.37, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N'-hydroxy-4-methoxybenzenecarboximidamide is sourced from PubChem (CID 83385991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).