About 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid
2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid (PubChem CID 83386002) has the molecular formula C8H8N2O3
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid |
| PubChem CID | 83386002 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid |
| SMILES | N/C(=N\O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8N2O3/c9-7(10-13)5-3-1-2-4-6(5)8(11)12/h1-4,13H,(H2,9,10)(H,11,12) |
| InChIKey | ADABLPLLJHXDJT-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid?
The IUPAC name of 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid (CID 83386002) is 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid.
What is the SMILES notation for 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid?
The canonical SMILES for 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid is N/C(=N\O)c1ccccc1C(=O)O.
What is the InChIKey of 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid?
The InChIKey is ADABLPLLJHXDJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3/c9-7(10-13)5-3-1-2-4-6(5)8(11)12/h1-4,13H,(H2,9,10)(H,11,12).
What are the key properties of 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid?
2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid has a molecular weight of 180.16 g/mol, XLogP of 0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-N'-hydroxycarbamimidoyl]benzoic acid is sourced from PubChem (CID 83386002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).