C12H14N2O — CID 83392864
(3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethanol (PubChem CID 83392864) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethanol.
| Compound Name | (3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethanol |
|---|---|
| PubChem CID | 83392864 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (3,5-dimethyl-1H-pyrazol-4-yl)-phenylmethanol |
| SMILES | Cc1n[nH]c(C)c1C(O)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O/c1-8-11(9(2)14-13-8)12(15)10-6-4-3-5-7-10/h3-7,12,15H,1-2H3,(H,13,14) |
| InChIKey | RCJACQXEXYRXSQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |