C7H4F3NO3 — CID 83396351
4,4,4-trifluoro-1-(1,3-oxazol-2-yl)butane-1,3-dione (PubChem CID 83396351) has the molecular formula C7H4F3NO3 and a molecular weight of 207.11 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(1,3-oxazol-2-yl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-(1,3-oxazol-2-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 83396351 |
| Molecular Formula | C7H4F3NO3 |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 4,4,4-trifluoro-1-(1,3-oxazol-2-yl)butane-1,3-dione |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ncco1 |
| InChI | InChI=1S/C7H4F3NO3/c8-7(9,10)5(13)3-4(12)6-11-1-2-14-6/h1-2H,3H2 |
| InChIKey | SBEIMSMWHDYULI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|