C10H4F2O3 — CID 83396955
6,8-difluoro-4-oxochromene-3-carbaldehyde (PubChem CID 83396955) has the molecular formula C10H4F2O3 and a molecular weight of 210.13 g/mol. Its IUPAC name is 6,8-difluoro-4-oxochromene-3-carbaldehyde.
| Compound Name | 6,8-difluoro-4-oxochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 83396955 |
| Molecular Formula | C10H4F2O3 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 6,8-difluoro-4-oxochromene-3-carbaldehyde |
| SMILES | O=Cc1coc2c(F)cc(F)cc2c1=O |
| InChI | InChI=1S/C10H4F2O3/c11-6-1-7-9(14)5(3-13)4-15-10(7)8(12)2-6/h1-4H |
| InChIKey | IQYWFRXDUXUPRY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|