About 8-bromo-5-fluoro-3,4-dihydrochromen-2-one
8-bromo-5-fluoro-3,4-dihydrochromen-2-one (PubChem CID 83397294) has the molecular formula C9H6BrFO2
and a molecular weight of 245.05 g/mol. Its IUPAC name is 8-bromo-5-fluoro-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 8-bromo-5-fluoro-3,4-dihydrochromen-2-one |
| PubChem CID | 83397294 |
| Molecular Formula | C9H6BrFO2 |
| Molecular Weight | 245.05 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 8-bromo-5-fluoro-3,4-dihydrochromen-2-one |
| SMILES | O=C1CCc2c(F)ccc(Br)c2O1 |
| InChI | InChI=1S/C9H6BrFO2/c10-6-2-3-7(11)5-1-4-8(12)13-9(5)6/h2-3H,1,4H2 |
| InChIKey | JDIZSMBXHHPIGL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.05 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-5-fluoro-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-5-fluoro-3,4-dihydrochromen-2-one?
The IUPAC name of 8-bromo-5-fluoro-3,4-dihydrochromen-2-one (CID 83397294) is 8-bromo-5-fluoro-3,4-dihydrochromen-2-one.
What is the SMILES notation for 8-bromo-5-fluoro-3,4-dihydrochromen-2-one?
The canonical SMILES for 8-bromo-5-fluoro-3,4-dihydrochromen-2-one is O=C1CCc2c(F)ccc(Br)c2O1.
What is the InChIKey of 8-bromo-5-fluoro-3,4-dihydrochromen-2-one?
The InChIKey is JDIZSMBXHHPIGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrFO2/c10-6-2-3-7(11)5-1-4-8(12)13-9(5)6/h2-3H,1,4H2.
What are the key properties of 8-bromo-5-fluoro-3,4-dihydrochromen-2-one?
8-bromo-5-fluoro-3,4-dihydrochromen-2-one has a molecular weight of 245.05 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-5-fluoro-3,4-dihydrochromen-2-one is sourced from PubChem (CID 83397294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).