About 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one
2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 83397527) has the molecular formula C11H10F3NO2
and a molecular weight of 245.20 g/mol. Its IUPAC name is 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| PubChem CID | 83397527 |
| Molecular Formula | C11H10F3NO2 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)Oc2ccc(C(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C11H10F3NO2/c1-10(2)9(16)15-7-5-6(11(12,13)14)3-4-8(7)17-10/h3-5H,1-2H3,(H,15,16) |
| InChIKey | KVGQIRCTCZFWNN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one?
The IUPAC name of 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CID 83397527) is 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one is CC1(C)Oc2ccc(C(F)(F)F)cc2NC1=O.
What is the InChIKey of 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one?
The InChIKey is KVGQIRCTCZFWNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO2/c1-10(2)9(16)15-7-5-6(11(12,13)14)3-4-8(7)17-10/h3-5H,1-2H3,(H,15,16).
What are the key properties of 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one?
2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one has a molecular weight of 245.20 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 83397527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).