About 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine
3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine (PubChem CID 83397563) has the molecular formula C11H15FN2O
and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine |
| PubChem CID | 83397563 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine |
| SMILES | NCCCN1CCOc2cc(F)ccc21 |
| InChI | InChI=1S/C11H15FN2O/c12-9-2-3-10-11(8-9)15-7-6-14(10)5-1-4-13/h2-3,8H,1,4-7,13H2 |
| InChIKey | LTSRMGGZYIXRJH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine?
The IUPAC name of 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine (CID 83397563) is 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine.
What is the SMILES notation for 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine?
The canonical SMILES for 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine is NCCCN1CCOc2cc(F)ccc21.
What is the InChIKey of 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine?
The InChIKey is LTSRMGGZYIXRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2O/c12-9-2-3-10-11(8-9)15-7-6-14(10)5-1-4-13/h2-3,8H,1,4-7,13H2.
What are the key properties of 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine?
3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine has a molecular weight of 210.25 g/mol, XLogP of 1.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)propan-1-amine is sourced from PubChem (CID 83397563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).