C16H25NO2 — CID 83405819
4-methoxy-2-methyl-N-(2-methylpropyl)-5-propan-2-ylbenzamide (PubChem CID 83405819) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-methoxy-2-methyl-N-(2-methylpropyl)-5-propan-2-ylbenzamide.
| Compound Name | 4-methoxy-2-methyl-N-(2-methylpropyl)-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 83405819 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 4-methoxy-2-methyl-N-(2-methylpropyl)-5-propan-2-ylbenzamide |
| SMILES | COc1cc(C)c(C(=O)NCC(C)C)cc1C(C)C |
| InChI | InChI=1S/C16H25NO2/c1-10(2)9-17-16(18)14-8-13(11(3)4)15(19-6)7-12(14)5/h7-8,10-11H,9H2,1-6H3,(H,17,18) |
| InChIKey | CRSAREQXNGGNIB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |