C13H13F3N2O — CID 83406646
5-cyano-N-(2,2-dimethylpropyl)-2,3,4-trifluorobenzamide (PubChem CID 83406646) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 5-cyano-N-(2,2-dimethylpropyl)-2,3,4-trifluorobenzamide.
| Compound Name | 5-cyano-N-(2,2-dimethylpropyl)-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 83406646 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-cyano-N-(2,2-dimethylpropyl)-2,3,4-trifluorobenzamide |
| SMILES | CC(C)(C)CNC(=O)c1cc(C#N)c(F)c(F)c1F |
| InChI | InChI=1S/C13H13F3N2O/c1-13(2,3)6-18-12(19)8-4-7(5-17)9(14)11(16)10(8)15/h4H,6H2,1-3H3,(H,18,19) |
| InChIKey | JARHRYOVQHZQAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|