C10H11ClF3NO — CID 83409127
3-[2-chloro-4-(trifluoromethyl)phenoxy]propan-1-amine (PubChem CID 83409127) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-[2-chloro-4-(trifluoromethyl)phenoxy]propan-1-amine.
| Compound Name | 3-[2-chloro-4-(trifluoromethyl)phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 83409127 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-[2-chloro-4-(trifluoromethyl)phenoxy]propan-1-amine |
| SMILES | NCCCOc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3NO/c11-8-6-7(10(12,13)14)2-3-9(8)16-5-1-4-15/h2-3,6H,1,4-5,15H2 |
| InChIKey | LDMWJSSSFJFGCX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|