About 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile
2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile (PubChem CID 83410571) has the molecular formula C9H2F5NO
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile.
Molecular Properties
| Compound Name | 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile |
| PubChem CID | 83410571 |
| Molecular Formula | C9H2F5NO |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile |
| SMILES | N#Cc1ccc(F)c(C(=O)C(F)(F)F)c1F |
| InChI | InChI=1S/C9H2F5NO/c10-5-2-1-4(3-15)7(11)6(5)8(16)9(12,13)14/h1-2H |
| InChIKey | TZEZADCBTKOYFP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile?
The IUPAC name of 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile (CID 83410571) is 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile.
What is the SMILES notation for 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile?
The canonical SMILES for 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile is N#Cc1ccc(F)c(C(=O)C(F)(F)F)c1F.
What is the InChIKey of 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile?
The InChIKey is TZEZADCBTKOYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H2F5NO/c10-5-2-1-4(3-15)7(11)6(5)8(16)9(12,13)14/h1-2H.
What are the key properties of 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile?
2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile has a molecular weight of 235.11 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-3-(2,2,2-trifluoroacetyl)benzonitrile is sourced from PubChem (CID 83410571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).