About 1-benzyl-5,6-dimethoxyindazole
1-benzyl-5,6-dimethoxyindazole (PubChem CID 83414174) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-benzyl-5,6-dimethoxyindazole.
Molecular Properties
| Compound Name | 1-benzyl-5,6-dimethoxyindazole |
| PubChem CID | 83414174 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-benzyl-5,6-dimethoxyindazole |
| SMILES | COc1cc2cnn(Cc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C16H16N2O2/c1-19-15-8-13-10-17-18(14(13)9-16(15)20-2)11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | SRVJNGSFCZTXHO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-5,6-dimethoxyindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-5,6-dimethoxyindazole?
The IUPAC name of 1-benzyl-5,6-dimethoxyindazole (CID 83414174) is 1-benzyl-5,6-dimethoxyindazole.
What is the SMILES notation for 1-benzyl-5,6-dimethoxyindazole?
The canonical SMILES for 1-benzyl-5,6-dimethoxyindazole is COc1cc2cnn(Cc3ccccc3)c2cc1OC.
What is the InChIKey of 1-benzyl-5,6-dimethoxyindazole?
The InChIKey is SRVJNGSFCZTXHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-19-15-8-13-10-17-18(14(13)9-16(15)20-2)11-12-6-4-3-5-7-12/h3-10H,11H2,1-2H3.
What are the key properties of 1-benzyl-5,6-dimethoxyindazole?
1-benzyl-5,6-dimethoxyindazole has a molecular weight of 268.32 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-5,6-dimethoxyindazole is sourced from PubChem (CID 83414174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).