C9H14N2O — CID 83414585
5-methoxy-1-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 83414585) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 5-methoxy-1-methyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 5-methoxy-1-methyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 83414585 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 5-methoxy-1-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | COC1CCc2c(cnn2C)C1 |
| InChI | InChI=1S/C9H14N2O/c1-11-9-4-3-8(12-2)5-7(9)6-10-11/h6,8H,3-5H2,1-2H3 |
| InChIKey | ZIEZLPNBLIQEFQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |