C9H12N2O2 — CID 83414589
1-methyl-4,5,6,7-tetrahydroindazole-7-carboxylic acid (PubChem CID 83414589) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydroindazole-7-carboxylic acid.
| Compound Name | 1-methyl-4,5,6,7-tetrahydroindazole-7-carboxylic acid |
|---|---|
| PubChem CID | 83414589 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 1-methyl-4,5,6,7-tetrahydroindazole-7-carboxylic acid |
| SMILES | Cn1ncc2c1C(C(=O)O)CCC2 |
| InChI | InChI=1S/C9H12N2O2/c1-11-8-6(5-10-11)3-2-4-7(8)9(12)13/h5,7H,2-4H2,1H3,(H,12,13) |
| InChIKey | LXAJZMQZMREPNA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |