C10H13N3S — CID 83417654
3-(3-aminopropyl)-1H-benzimidazole-2-thione (PubChem CID 83417654) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 3-(3-aminopropyl)-1H-benzimidazole-2-thione.
| Compound Name | 3-(3-aminopropyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83417654 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(3-aminopropyl)-1H-benzimidazole-2-thione |
| SMILES | NCCCn1c(=S)[nH]c2ccccc21 |
| InChI | InChI=1S/C10H13N3S/c11-6-3-7-13-9-5-2-1-4-8(9)12-10(13)14/h1-2,4-5H,3,6-7,11H2,(H,12,14) |
| InChIKey | SIZMAKFTDVTFNI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|