C8H10N4 — CID 83418174
2-methylbenzimidazole-1,5-diamine (PubChem CID 83418174) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-methylbenzimidazole-1,5-diamine.
| Compound Name | 2-methylbenzimidazole-1,5-diamine |
|---|---|
| PubChem CID | 83418174 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-methylbenzimidazole-1,5-diamine |
| SMILES | Cc1nc2cc(N)ccc2n1N |
| InChI | InChI=1S/C8H10N4/c1-5-11-7-4-6(9)2-3-8(7)12(5)10/h2-4H,9-10H2,1H3 |
| InChIKey | RCDSNEMHDVERQK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|