About 2,3-dichloronaphthalene-1,4-dione
2,3-dichloronaphthalene-1,4-dione (PubChem CID 8342) has the molecular formula C10H4Cl2O2
and a molecular weight of 227.05 g/mol. Its IUPAC name is 2,3-dichloronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2,3-dichloronaphthalene-1,4-dione |
| PubChem CID | 8342 |
| Molecular Formula | C10H4Cl2O2 |
| Molecular Weight | 227.05 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | 2,3-dichloronaphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H |
| InChIKey | SVPKNMBRVBMTLB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.05 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloronaphthalene-1,4-dione?
The IUPAC name of 2,3-dichloronaphthalene-1,4-dione (CID 8342) is 2,3-dichloronaphthalene-1,4-dione.
What is the SMILES notation for 2,3-dichloronaphthalene-1,4-dione?
The canonical SMILES for 2,3-dichloronaphthalene-1,4-dione is O=C1C(Cl)=C(Cl)C(=O)c2ccccc21.
What is the InChIKey of 2,3-dichloronaphthalene-1,4-dione?
The InChIKey is SVPKNMBRVBMTLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H4Cl2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H.
What are the key properties of 2,3-dichloronaphthalene-1,4-dione?
2,3-dichloronaphthalene-1,4-dione has a molecular weight of 227.05 g/mol, XLogP of 2.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloronaphthalene-1,4-dione is sourced from PubChem (CID 8342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).