About (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol
(3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol (PubChem CID 83434426) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol.
Analyze (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol?
The IUPAC name of (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol (CID 83434426) is (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol.
What is the SMILES notation for (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol?
The canonical SMILES for (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol is Cn1cnc2c1C(CO)CCC2.
What is the InChIKey of (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol?
The InChIKey is HKJFRMFHTSOZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-11-6-10-8-4-2-3-7(5-12)9(8)11/h6-7,12H,2-5H2,1H3.
What are the key properties of (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol?
(3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol has a molecular weight of 166.22 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4,5,6,7-tetrahydrobenzimidazol-4-yl)methanol is sourced from PubChem (CID 83434426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).