About 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile
8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile (PubChem CID 834351) has the molecular formula C16H15N3O
and a molecular weight of 265.32 g/mol. Its IUPAC name is 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile |
| PubChem CID | 834351 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile |
| SMILES | Cc1cc2n(c(=O)c1C#N)CCCN2c1ccccc1 |
| InChI | InChI=1S/C16H15N3O/c1-12-10-15-18(13-6-3-2-4-7-13)8-5-9-19(15)16(20)14(12)11-17/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | LESQMKQWQMZHFV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile?
The IUPAC name of 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile (CID 834351) is 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile.
What is the SMILES notation for 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile?
The canonical SMILES for 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile is Cc1cc2n(c(=O)c1C#N)CCCN2c1ccccc1.
What is the InChIKey of 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile?
The InChIKey is LESQMKQWQMZHFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O/c1-12-10-15-18(13-6-3-2-4-7-13)8-5-9-19(15)16(20)14(12)11-17/h2-4,6-7,10H,5,8-9H2,1H3.
What are the key properties of 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile?
8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile has a molecular weight of 265.32 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6-oxo-1-phenyl-3,4-dihydro-2H-pyrido[1,2-a]pyrimidine-7-carbonitrile is sourced from PubChem (CID 834351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).