C9H15N3S — CID 83435603
3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione (PubChem CID 83435603) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione.
| Compound Name | 3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83435603 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione |
| SMILES | NCCn1c2c([nH]c1=S)CCCC2 |
| InChI | InChI=1S/C9H15N3S/c10-5-6-12-8-4-2-1-3-7(8)11-9(12)13/h1-6,10H2,(H,11,13) |
| InChIKey | XCBZAISUSDGPNF-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|