C9H16N4S — CID 83436464
6-amino-3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione (PubChem CID 83436464) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 6-amino-3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione.
| Compound Name | 6-amino-3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 83436464 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 6-amino-3-(2-aminoethyl)-4,5,6,7-tetrahydro-1H-benzimidazole-2-thione |
| SMILES | NCCn1c2c([nH]c1=S)CC(N)CC2 |
| InChI | InChI=1S/C9H16N4S/c10-3-4-13-8-2-1-6(11)5-7(8)12-9(13)14/h6H,1-5,10-11H2,(H,12,14) |
| InChIKey | LUHWUJQQGQVNAO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 72.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|