4-morpholin-3-ylbenzoic acid

C11H13NO3 — CID 83439810

IUPAC4-morpholin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(C2COCCN2)cc1
InChIInChI=1S/C11H13NO3/c13-11(14)9-3-1-8(2-4-9)10-7-15-6-5-12-10/h1-4,10,12H,5-7H2,(H,13,14)
InChIKeyVXKDQKITHTVHEW-UHFFFAOYSA-N
MW207.23 g/mol
LogP1.05
Rot. Bonds2

About 4-morpholin-3-ylbenzoic acid

4-morpholin-3-ylbenzoic acid (PubChem CID 83439810) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-morpholin-3-ylbenzoic acid.

Molecular Properties

Compound Name4-morpholin-3-ylbenzoic acid
PubChem CID83439810
Molecular FormulaC11H13NO3
Molecular Weight207.23 g/mol
Exact Mass207.09
IUPAC Name4-morpholin-3-ylbenzoic acid
SMILESO=C(O)c1ccc(C2COCCN2)cc1
InChIInChI=1S/C11H13NO3/c13-11(14)9-3-1-8(2-4-9)10-7-15-6-5-12-10/h1-4,10,12H,5-7H2,(H,13,14)
InChIKeyVXKDQKITHTVHEW-UHFFFAOYSA-N
XLogP1.05
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.23
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-morpholin-3-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-morpholin-3-ylbenzoic acid?
The IUPAC name of 4-morpholin-3-ylbenzoic acid (CID 83439810) is 4-morpholin-3-ylbenzoic acid.
What is the SMILES notation for 4-morpholin-3-ylbenzoic acid?
The canonical SMILES for 4-morpholin-3-ylbenzoic acid is O=C(O)c1ccc(C2COCCN2)cc1.
What is the InChIKey of 4-morpholin-3-ylbenzoic acid?
The InChIKey is VXKDQKITHTVHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO3/c13-11(14)9-3-1-8(2-4-9)10-7-15-6-5-12-10/h1-4,10,12H,5-7H2,(H,13,14).
What are the key properties of 4-morpholin-3-ylbenzoic acid?
4-morpholin-3-ylbenzoic acid has a molecular weight of 207.23 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-morpholin-3-ylbenzoic acid is sourced from PubChem (CID 83439810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).