About 1,6,7-trimethylbenzimidazole
1,6,7-trimethylbenzimidazole (PubChem CID 83449271) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,6,7-trimethylbenzimidazole.
Molecular Properties
| Compound Name | 1,6,7-trimethylbenzimidazole |
| PubChem CID | 83449271 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1,6,7-trimethylbenzimidazole |
| SMILES | Cc1ccc2ncn(C)c2c1C |
| InChI | InChI=1S/C10H12N2/c1-7-4-5-9-10(8(7)2)12(3)6-11-9/h4-6H,1-3H3 |
| InChIKey | QQWCAKLNPMCTES-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6,7-trimethylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6,7-trimethylbenzimidazole?
The IUPAC name of 1,6,7-trimethylbenzimidazole (CID 83449271) is 1,6,7-trimethylbenzimidazole.
What is the SMILES notation for 1,6,7-trimethylbenzimidazole?
The canonical SMILES for 1,6,7-trimethylbenzimidazole is Cc1ccc2ncn(C)c2c1C.
What is the InChIKey of 1,6,7-trimethylbenzimidazole?
The InChIKey is QQWCAKLNPMCTES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-7-4-5-9-10(8(7)2)12(3)6-11-9/h4-6H,1-3H3.
What are the key properties of 1,6,7-trimethylbenzimidazole?
1,6,7-trimethylbenzimidazole has a molecular weight of 160.22 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6,7-trimethylbenzimidazole is sourced from PubChem (CID 83449271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).