About 3-(2-isocyanoethyl)-2,5-dimethylfuran
3-(2-isocyanoethyl)-2,5-dimethylfuran (PubChem CID 83479425) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 3-(2-isocyanoethyl)-2,5-dimethylfuran.
Molecular Properties
| Compound Name | 3-(2-isocyanoethyl)-2,5-dimethylfuran |
| PubChem CID | 83479425 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 3-(2-isocyanoethyl)-2,5-dimethylfuran |
| SMILES | [C-]#[N+]CCc1cc(C)oc1C |
| InChI | InChI=1S/C9H11NO/c1-7-6-9(4-5-10-3)8(2)11-7/h6H,4-5H2,1-2H3 |
| InChIKey | SDXRZGGRRHPDDF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 17.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-isocyanoethyl)-2,5-dimethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-isocyanoethyl)-2,5-dimethylfuran?
The IUPAC name of 3-(2-isocyanoethyl)-2,5-dimethylfuran (CID 83479425) is 3-(2-isocyanoethyl)-2,5-dimethylfuran.
What is the SMILES notation for 3-(2-isocyanoethyl)-2,5-dimethylfuran?
The canonical SMILES for 3-(2-isocyanoethyl)-2,5-dimethylfuran is [C-]#[N+]CCc1cc(C)oc1C.
What is the InChIKey of 3-(2-isocyanoethyl)-2,5-dimethylfuran?
The InChIKey is SDXRZGGRRHPDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-7-6-9(4-5-10-3)8(2)11-7/h6H,4-5H2,1-2H3.
What are the key properties of 3-(2-isocyanoethyl)-2,5-dimethylfuran?
3-(2-isocyanoethyl)-2,5-dimethylfuran has a molecular weight of 149.19 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-isocyanoethyl)-2,5-dimethylfuran is sourced from PubChem (CID 83479425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).