About 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine
6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 83479498) has the molecular formula C8H10N2O
and a molecular weight of 150.18 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 83479498 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc2c(n1)NCC2 |
| InChI | InChI=1S/C8H10N2O/c1-11-7-3-2-6-4-5-9-8(6)10-7/h2-3H,4-5H2,1H3,(H,9,10) |
| InChIKey | SEFUFJNUFYWOOC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 83479498) is 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is COc1ccc2c(n1)NCC2.
What is the InChIKey of 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is SEFUFJNUFYWOOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O/c1-11-7-3-2-6-4-5-9-8(6)10-7/h2-3H,4-5H2,1H3,(H,9,10).
What are the key properties of 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine?
6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 150.18 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,3-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 83479498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).