About 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran
7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran (PubChem CID 83481550) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran |
| PubChem CID | 83481550 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]CCc1cccc2c1OCC2 |
| InChI | InChI=1S/C11H11NO/c1-12-7-5-9-3-2-4-10-6-8-13-11(9)10/h2-4H,5-8H2 |
| InChIKey | SIQADCGNYFAHLB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran?
The IUPAC name of 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran (CID 83481550) is 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran.
What is the SMILES notation for 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran?
The canonical SMILES for 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran is [C-]#[N+]CCc1cccc2c1OCC2.
What is the InChIKey of 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran?
The InChIKey is SIQADCGNYFAHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-12-7-5-9-3-2-4-10-6-8-13-11(9)10/h2-4H,5-8H2.
What are the key properties of 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran?
7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran has a molecular weight of 173.21 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-isocyanoethyl)-2,3-dihydro-1-benzofuran is sourced from PubChem (CID 83481550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).