About 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde
2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde (PubChem CID 83483766) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde |
| PubChem CID | 83483766 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde |
| SMILES | CC1Nc2ccc(C=O)cc2NC1=O |
| InChI | InChI=1S/C10H10N2O2/c1-6-10(14)12-9-4-7(5-13)2-3-8(9)11-6/h2-6,11H,1H3,(H,12,14) |
| InChIKey | GMMGMRUFNMLCOX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde?
The IUPAC name of 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde (CID 83483766) is 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde.
What is the SMILES notation for 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde?
The canonical SMILES for 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde is CC1Nc2ccc(C=O)cc2NC1=O.
What is the InChIKey of 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde?
The InChIKey is GMMGMRUFNMLCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-6-10(14)12-9-4-7(5-13)2-3-8(9)11-6/h2-6,11H,1H3,(H,12,14).
What are the key properties of 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde?
2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde has a molecular weight of 190.20 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-oxo-2,4-dihydro-1H-quinoxaline-6-carbaldehyde is sourced from PubChem (CID 83483766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).