About 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one
4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one (PubChem CID 83484951) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one.
Molecular Properties
| Compound Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one |
| PubChem CID | 83484951 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one |
| SMILES | Cc1nc(CC2COCC2=O)cs1 |
| InChI | InChI=1S/C9H11NO2S/c1-6-10-8(5-13-6)2-7-3-12-4-9(7)11/h5,7H,2-4H2,1H3 |
| InChIKey | ZQOUOZUJGIOFBS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one?
The IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one (CID 83484951) is 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one.
What is the SMILES notation for 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one?
The canonical SMILES for 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one is Cc1nc(CC2COCC2=O)cs1.
What is the InChIKey of 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one?
The InChIKey is ZQOUOZUJGIOFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-6-10-8(5-13-6)2-7-3-12-4-9(7)11/h5,7H,2-4H2,1H3.
What are the key properties of 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one?
4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one has a molecular weight of 197.26 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,3-thiazol-4-yl)methyl]oxolan-3-one is sourced from PubChem (CID 83484951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).