About 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde
5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde (PubChem CID 83485224) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 83485224 |
| Molecular Formula | C8H9NO3S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1cnoc1C1CCS(=O)C1 |
| InChI | InChI=1S/C8H9NO3S/c10-4-7-3-9-12-8(7)6-1-2-13(11)5-6/h3-4,6H,1-2,5H2 |
| InChIKey | ROIFRJPBQSUHKU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde (CID 83485224) is 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde is O=Cc1cnoc1C1CCS(=O)C1.
What is the InChIKey of 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde?
The InChIKey is ROIFRJPBQSUHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c10-4-7-3-9-12-8(7)6-1-2-13(11)5-6/h3-4,6H,1-2,5H2.
What are the key properties of 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde?
5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde has a molecular weight of 199.23 g/mol, XLogP of 0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-oxothiolan-3-yl)-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 83485224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).