C9H7BrN2O2 — CID 83488501
7-bromo-5-methoxypyrazolo[1,5-a]pyridine-3-carbaldehyde (PubChem CID 83488501) has the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. Its IUPAC name is 7-bromo-5-methoxypyrazolo[1,5-a]pyridine-3-carbaldehyde.
| Compound Name | 7-bromo-5-methoxypyrazolo[1,5-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 83488501 |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 7-bromo-5-methoxypyrazolo[1,5-a]pyridine-3-carbaldehyde |
| SMILES | COc1cc(Br)n2ncc(C=O)c2c1 |
| InChI | InChI=1S/C9H7BrN2O2/c1-14-7-2-8-6(5-13)4-11-12(8)9(10)3-7/h2-5H,1H3 |
| InChIKey | VZXZWXPVANCOMY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|