C16H17N3O2 — CID 83493794
6-amino-4-benzyl-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 83493794) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 6-amino-4-benzyl-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-amino-4-benzyl-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 83493794 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 6-amino-4-benzyl-2,2-dimethylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Oc2ccc(N)nc2N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C16H17N3O2/c1-16(2)15(20)19(10-11-6-4-3-5-7-11)14-12(21-16)8-9-13(17)18-14/h3-9H,10H2,1-2H3,(H2,17,18) |
| InChIKey | WUUZEACNCDZMKO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |