C14H15N2OS+ — CID 834959
8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium (PubChem CID 834959) has the molecular formula C14H15N2OS+ and a molecular weight of 259.35 g/mol. Its IUPAC name is 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium.
| Compound Name | 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium |
|---|---|
| PubChem CID | 834959 |
| Molecular Formula | C14H15N2OS+ |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 8-methoxy-2,3,4-trimethylpyrimido[2,1-b][1,3]benzothiazol-5-ium |
| SMILES | COc1ccc2c(c1)sc1nc(C)c(C)c(C)[n+]12 |
| InChI | InChI=1S/C14H15N2OS/c1-8-9(2)15-14-16(10(8)3)12-6-5-11(17-4)7-13(12)18-14/h5-7H,1-4H3/q+1 |
| InChIKey | VJDGGBLMNLJRQK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|