About N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide
N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide (PubChem CID 835028) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide |
| PubChem CID | 835028 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(C)C)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C14H21NO2/c1-8(2)12-6-11(15-10(5)16)7-13(9(3)4)14(12)17/h6-9,17H,1-5H3,(H,15,16) |
| InChIKey | PHSJJLICQTWSOW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide?
The IUPAC name of N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide (CID 835028) is N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide.
What is the SMILES notation for N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide?
The canonical SMILES for N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide is CC(=O)Nc1cc(C(C)C)c(O)c(C(C)C)c1.
What is the InChIKey of N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide?
The InChIKey is PHSJJLICQTWSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-8(2)12-6-11(15-10(5)16)7-13(9(3)4)14(12)17/h6-9,17H,1-5H3,(H,15,16).
What are the key properties of N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide?
N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide has a molecular weight of 235.33 g/mol, XLogP of 3.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-hydroxy-3,5-di(propan-2-yl)phenyl]acetamide is sourced from PubChem (CID 835028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).