About 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone
2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone (PubChem CID 83515097) has the molecular formula C18H21N3OS
and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone |
| PubChem CID | 83515097 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone |
| SMILES | O=C(CN1CC2(CCNCC2)Nc2ccccc21)c1cccs1 |
| InChI | InChI=1S/C18H21N3OS/c22-16(17-6-3-11-23-17)12-21-13-18(7-9-19-10-8-18)20-14-4-1-2-5-15(14)21/h1-6,11,19-20H,7-10,12-13H2 |
| InChIKey | YTCIJFBLPVLGBP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone?
The IUPAC name of 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone (CID 83515097) is 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone.
What is the SMILES notation for 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone?
The canonical SMILES for 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone is O=C(CN1CC2(CCNCC2)Nc2ccccc21)c1cccs1.
What is the InChIKey of 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone?
The InChIKey is YTCIJFBLPVLGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3OS/c22-16(17-6-3-11-23-17)12-21-13-18(7-9-19-10-8-18)20-14-4-1-2-5-15(14)21/h1-6,11,19-20H,7-10,12-13H2.
What are the key properties of 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone?
2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone has a molecular weight of 327.45 g/mol, XLogP of 2.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[2,4-dihydroquinoxaline-3,4'-piperidine]-1-yl-1-thiophen-2-ylethanone is sourced from PubChem (CID 83515097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).