C15H15F6NO — CID 835158
2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 835158) has the molecular formula C15H15F6NO and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 835158 |
| Molecular Formula | C15H15F6NO |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[(3,3-dimethyl-4H-isoquinolin-1-yl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1(C)Cc2ccccc2C(CC(O)(C(F)(F)F)C(F)(F)F)=N1 |
| InChI | InChI=1S/C15H15F6NO/c1-12(2)7-9-5-3-4-6-10(9)11(22-12)8-13(23,14(16,17)18)15(19,20)21/h3-6,23H,7-8H2,1-2H3 |
| InChIKey | GBNWQDZRAIFXFL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |