About 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine
6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine (PubChem CID 83526327) has the molecular formula C7H5BrClN3
and a molecular weight of 246.50 g/mol. Its IUPAC name is 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 83526327 |
| Molecular Formula | C7H5BrClN3 |
| Molecular Weight | 246.50 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine |
| SMILES | Nc1cn2cc(Br)cc(Cl)c2n1 |
| InChI | InChI=1S/C7H5BrClN3/c8-4-1-5(9)7-11-6(10)3-12(7)2-4/h1-3H,10H2 |
| InChIKey | PYUZONJPPJUFJR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine (CID 83526327) is 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine is Nc1cn2cc(Br)cc(Cl)c2n1.
What is the InChIKey of 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is PYUZONJPPJUFJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrClN3/c8-4-1-5(9)7-11-6(10)3-12(7)2-4/h1-3H,10H2.
What are the key properties of 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine?
6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 246.50 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-8-chloroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 83526327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).