C14H16N2O2 — CID 83528569
8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[c][2,7]naphthyridine (PubChem CID 83528569) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[c][2,7]naphthyridine.
| Compound Name | 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[c][2,7]naphthyridine |
|---|---|
| PubChem CID | 83528569 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 8,9-dimethoxy-1,2,3,4-tetrahydrobenzo[c][2,7]naphthyridine |
| SMILES | COc1cc2ncc3c(c2cc1OC)CCNC3 |
| InChI | InChI=1S/C14H16N2O2/c1-17-13-5-11-10-3-4-15-7-9(10)8-16-12(11)6-14(13)18-2/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | VCFWHTFEOKMQPH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |