1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid

C7H11NO3 — CID 83529056

IUPAC1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid
SMILESCN1CC(C)(C(=O)O)CC1=O
InChIInChI=1S/C7H11NO3/c1-7(6(10)11)3-5(9)8(2)4-7/h3-4H2,1-2H3,(H,10,11)
InChIKeyVAWAHMBIMWIMAA-UHFFFAOYSA-N
MW157.17 g/mol
LogP-0.06
Rot. Bonds1

About 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid

1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 83529056) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid
PubChem CID83529056
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Name1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid
SMILESCN1CC(C)(C(=O)O)CC1=O
InChIInChI=1S/C7H11NO3/c1-7(6(10)11)3-5(9)8(2)4-7/h3-4H2,1-2H3,(H,10,11)
InChIKeyVAWAHMBIMWIMAA-UHFFFAOYSA-N
XLogP-0.06
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 5-0.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid?
The IUPAC name of 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid (CID 83529056) is 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid?
The canonical SMILES for 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid is CN1CC(C)(C(=O)O)CC1=O.
What is the InChIKey of 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid?
The InChIKey is VAWAHMBIMWIMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-7(6(10)11)3-5(9)8(2)4-7/h3-4H2,1-2H3,(H,10,11).
What are the key properties of 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid?
1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-oxopyrrolidine-3-carboxylic acid is sourced from PubChem (CID 83529056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).