6-ethyl-4-oxopyran-2-carboxylic acid

C8H8O4 — CID 83529330

IUPAC6-ethyl-4-oxopyran-2-carboxylic acid
SMILESCCc1cc(=O)cc(C(=O)O)o1
InChIInChI=1S/C8H8O4/c1-2-6-3-5(9)4-7(12-6)8(10)11/h3-4H,2H2,1H3,(H,10,11)
InChIKeyUXDKJHBRKINZGM-UHFFFAOYSA-N
MW168.15 g/mol
LogP0.90
Rot. Bonds2

About 6-ethyl-4-oxopyran-2-carboxylic acid

6-ethyl-4-oxopyran-2-carboxylic acid (PubChem CID 83529330) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 6-ethyl-4-oxopyran-2-carboxylic acid.

Molecular Properties

Compound Name6-ethyl-4-oxopyran-2-carboxylic acid
PubChem CID83529330
Molecular FormulaC8H8O4
Molecular Weight168.15 g/mol
Exact Mass168.04
IUPAC Name6-ethyl-4-oxopyran-2-carboxylic acid
SMILESCCc1cc(=O)cc(C(=O)O)o1
InChIInChI=1S/C8H8O4/c1-2-6-3-5(9)4-7(12-6)8(10)11/h3-4H,2H2,1H3,(H,10,11)
InChIKeyUXDKJHBRKINZGM-UHFFFAOYSA-N
XLogP0.90
TPSA67.51 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 50.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-ethyl-4-oxopyran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-ethyl-4-oxopyran-2-carboxylic acid?
The IUPAC name of 6-ethyl-4-oxopyran-2-carboxylic acid (CID 83529330) is 6-ethyl-4-oxopyran-2-carboxylic acid.
What is the SMILES notation for 6-ethyl-4-oxopyran-2-carboxylic acid?
The canonical SMILES for 6-ethyl-4-oxopyran-2-carboxylic acid is CCc1cc(=O)cc(C(=O)O)o1.
What is the InChIKey of 6-ethyl-4-oxopyran-2-carboxylic acid?
The InChIKey is UXDKJHBRKINZGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4/c1-2-6-3-5(9)4-7(12-6)8(10)11/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 6-ethyl-4-oxopyran-2-carboxylic acid?
6-ethyl-4-oxopyran-2-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-oxopyran-2-carboxylic acid is sourced from PubChem (CID 83529330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).