C11H19N3 — CID 83531084
2-N,4,6-trimethyl-2-N-propylpyridine-2,5-diamine (PubChem CID 83531084) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-N,4,6-trimethyl-2-N-propylpyridine-2,5-diamine.
| Compound Name | 2-N,4,6-trimethyl-2-N-propylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 83531084 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-N,4,6-trimethyl-2-N-propylpyridine-2,5-diamine |
| SMILES | CCCN(C)c1cc(C)c(N)c(C)n1 |
| InChI | InChI=1S/C11H19N3/c1-5-6-14(4)10-7-8(2)11(12)9(3)13-10/h7H,5-6,12H2,1-4H3 |
| InChIKey | MMBNHDBUMQEPSX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |