C10H14Cl2N2 — CID 83539537
N'-(2,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 83539537) has the molecular formula C10H14Cl2N2 and a molecular weight of 233.14 g/mol. Its IUPAC name is N'-(2,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(2,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 83539537 |
| Molecular Formula | C10H14Cl2N2 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | N'-(2,4-dichlorophenyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2/c1-13-5-6-14(2)10-4-3-8(11)7-9(10)12/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | WSKHKNUOQCQFCG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |