About 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide
2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (PubChem CID 83568678) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| PubChem CID | 83568678 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc2c(nc1N)CCC2 |
| InChI | InChI=1S/C9H11N3O/c10-8-6(9(11)13)4-5-2-1-3-7(5)12-8/h4H,1-3H2,(H2,10,12)(H2,11,13) |
| InChIKey | FJYSPUCDTHFOBA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The IUPAC name of 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide (CID 83568678) is 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide.
What is the SMILES notation for 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The canonical SMILES for 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is NC(=O)c1cc2c(nc1N)CCC2.
What is the InChIKey of 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
The InChIKey is FJYSPUCDTHFOBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c10-8-6(9(11)13)4-5-2-1-3-7(5)12-8/h4H,1-3H2,(H2,10,12)(H2,11,13).
What are the key properties of 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide?
2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide has a molecular weight of 177.21 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carboxamide is sourced from PubChem (CID 83568678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).